C39H42O7 — CID 101205999
[(2R,3R,4S,5R,6R)-6-pent-4-enoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl benzoate (PubChem CID 101205999) has the molecular formula C39H42O7 and a molecular weight of 622.76 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-pent-4-enoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-pent-4-enoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101205999 |
| Molecular Formula | C39H42O7 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-pent-4-enoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl benzoate |
| SMILES | C=CCCCO[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H42O7/c1-2-3-16-25-41-39-37(44-28-32-21-12-6-13-22-32)36(43-27-31-19-10-5-11-20-31)35(42-26-30-17-8-4-9-18-30)34(46-39)29-45-38(40)33-23-14-7-15-24-33/h2,4-15,17-24,34-37,39H,1,3,16,25-29H2/t34-,35-,36+,37-,39-/m1/s1 |
| InChIKey | ZLTANNRCFKHDKV-MKJHBRGYSA-N |
| XLogP | 7.31 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|