C22H30O8 — CID 58627400
(5-acetyloxy-3-hydroxy-6-pent-4-enoxy-4-phenylmethoxyoxan-2-yl)methyl acetate (PubChem CID 58627400) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is (5-acetyloxy-3-hydroxy-6-pent-4-enoxy-4-phenylmethoxyoxan-2-yl)methyl acetate.
| Compound Name | (5-acetyloxy-3-hydroxy-6-pent-4-enoxy-4-phenylmethoxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 58627400 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (5-acetyloxy-3-hydroxy-6-pent-4-enoxy-4-phenylmethoxyoxan-2-yl)methyl acetate |
| SMILES | C=CCCCOC1OC(COC(C)=O)C(O)C(OCc2ccccc2)C1OC(C)=O |
| InChI | InChI=1S/C22H30O8/c1-4-5-9-12-26-22-21(29-16(3)24)20(28-13-17-10-7-6-8-11-17)19(25)18(30-22)14-27-15(2)23/h4,6-8,10-11,18-22,25H,1,5,9,12-14H2,2-3H3 |
| InChIKey | DCPMRAHCONTFJD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|