C20H28O5 — CID 11057178
[(1S,2R,4S,5S)-4-octoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate (PubChem CID 11057178) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(1S,2R,4S,5S)-4-octoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate.
| Compound Name | [(1S,2R,4S,5S)-4-octoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11057178 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(1S,2R,4S,5S)-4-octoxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
| SMILES | CCCCCCCCO[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C20H28O5/c1-2-3-4-5-6-10-13-22-20-18-17(25-18)16(24-20)14-23-19(21)15-11-8-7-9-12-15/h7-9,11-12,16-18,20H,2-6,10,13-14H2,1H3/t16-,17+,18+,20+/m1/s1 |
| InChIKey | PPKGXBMNJNPQDB-LXZJYRNTSA-N |
| XLogP | 3.71 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|