C18H22O5 — CID 11758951
[(1R,2R,4R,5R)-4-cyclohexyloxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate (PubChem CID 11758951) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(1R,2R,4R,5R)-4-cyclohexyloxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate.
| Compound Name | [(1R,2R,4R,5R)-4-cyclohexyloxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11758951 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(1R,2R,4R,5R)-4-cyclohexyloxy-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](OC2CCCCC2)[C@@H]2O[C@@H]21)c1ccccc1 |
| InChI | InChI=1S/C18H22O5/c19-17(12-7-3-1-4-8-12)20-11-14-15-16(23-15)18(22-14)21-13-9-5-2-6-10-13/h1,3-4,7-8,13-16,18H,2,5-6,9-11H2/t14-,15-,16-,18-/m1/s1 |
| InChIKey | METPQZJLWYFMID-YFHUEUNASA-N |
| XLogP | 2.68 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|