C22H26O5 — CID 101241157
[(1R,2R,5R)-4-(1-adamantyloxy)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate (PubChem CID 101241157) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(1R,2R,5R)-4-(1-adamantyloxy)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate.
| Compound Name | [(1R,2R,5R)-4-(1-adamantyloxy)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101241157 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [(1R,2R,5R)-4-(1-adamantyloxy)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(OC23CC4CC(CC(C4)C2)C3)[C@@H]2O[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C22H26O5/c23-20(16-4-2-1-3-5-16)24-12-17-18-19(26-18)21(25-17)27-22-9-13-6-14(10-22)8-15(7-13)11-22/h1-5,13-15,17-19,21H,6-12H2/t13?,14?,15?,17-,18-,19-,21?,22?/m1/s1 |
| InChIKey | OKNQJZUTKUVEQR-SVMMUNQLSA-N |
| XLogP | 3.32 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|