C30H34O5 — CID 101424320
[(2R,3S,6R)-6-(1-adamantyloxy)-3-phenylmethoxy-3,6-dihydro-2H-pyran-2-yl]methyl benzoate (PubChem CID 101424320) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is [(2R,3S,6R)-6-(1-adamantyloxy)-3-phenylmethoxy-3,6-dihydro-2H-pyran-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,6R)-6-(1-adamantyloxy)-3-phenylmethoxy-3,6-dihydro-2H-pyran-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101424320 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [(2R,3S,6R)-6-(1-adamantyloxy)-3-phenylmethoxy-3,6-dihydro-2H-pyran-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@H](OC23CC4CC(CC(C4)C2)C3)C=C[C@@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34O5/c31-29(25-9-5-2-6-10-25)33-20-27-26(32-19-21-7-3-1-4-8-21)11-12-28(34-27)35-30-16-22-13-23(17-30)15-24(14-22)18-30/h1-12,22-24,26-28H,13-20H2/t22?,23?,24?,26-,27+,28+,30?/m0/s1 |
| InChIKey | SFNVGRALSISHAJ-UPHDIKFNSA-N |
| XLogP | 5.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|