C19H20O3S — CID 144905520
[(2R,4S)-4-phenylmethoxythiolan-2-yl]methyl benzoate (PubChem CID 144905520) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is [(2R,4S)-4-phenylmethoxythiolan-2-yl]methyl benzoate.
| Compound Name | [(2R,4S)-4-phenylmethoxythiolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 144905520 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [(2R,4S)-4-phenylmethoxythiolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1C[C@H](OCc2ccccc2)CS1)c1ccccc1 |
| InChI | InChI=1S/C19H20O3S/c20-19(16-9-5-2-6-10-16)22-13-18-11-17(14-23-18)21-12-15-7-3-1-4-8-15/h1-10,17-18H,11-14H2/t17-,18+/m0/s1 |
| InChIKey | RIBNJLCYIWWHHP-ZWKOTPCHSA-N |
| XLogP | 3.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |