C20H20O6S — CID 144905604
[(2R,4S)-5-hydroxy-4-phenylmethoxycarbonyloxythiolan-2-yl]methyl benzoate (PubChem CID 144905604) has the molecular formula C20H20O6S and a molecular weight of 388.44 g/mol. Its IUPAC name is [(2R,4S)-5-hydroxy-4-phenylmethoxycarbonyloxythiolan-2-yl]methyl benzoate.
| Compound Name | [(2R,4S)-5-hydroxy-4-phenylmethoxycarbonyloxythiolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 144905604 |
| Molecular Formula | C20H20O6S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [(2R,4S)-5-hydroxy-4-phenylmethoxycarbonyloxythiolan-2-yl]methyl benzoate |
| SMILES | O=C(OCc1ccccc1)O[C@H]1C[C@H](COC(=O)c2ccccc2)SC1O |
| InChI | InChI=1S/C20H20O6S/c21-18(15-9-5-2-6-10-15)24-13-16-11-17(19(22)27-16)26-20(23)25-12-14-7-3-1-4-8-14/h1-10,16-17,19,22H,11-13H2/t16-,17+,19?/m1/s1 |
| InChIKey | ATCXLFZZMYCAAZ-FQZXCLDYSA-N |
| XLogP | 3.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |