C27H24O7 — CID 140504984
[(1R,2S,4S)-2,3-dibenzoyloxy-4-hydroxycyclopentyl]methyl benzoate (PubChem CID 140504984) has the molecular formula C27H24O7 and a molecular weight of 460.48 g/mol. Its IUPAC name is [(1R,2S,4S)-2,3-dibenzoyloxy-4-hydroxycyclopentyl]methyl benzoate.
| Compound Name | [(1R,2S,4S)-2,3-dibenzoyloxy-4-hydroxycyclopentyl]methyl benzoate |
|---|---|
| PubChem CID | 140504984 |
| Molecular Formula | C27H24O7 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [(1R,2S,4S)-2,3-dibenzoyloxy-4-hydroxycyclopentyl]methyl benzoate |
| SMILES | O=C(OC[C@H]1C[C@H](O)C(OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H24O7/c28-22-16-21(17-32-25(29)18-10-4-1-5-11-18)23(33-26(30)19-12-6-2-7-13-19)24(22)34-27(31)20-14-8-3-9-15-20/h1-15,21-24,28H,16-17H2/t21-,22+,23+,24?/m1/s1 |
| InChIKey | YXYPEXUFXKHHMZ-XDXUOVRZSA-N |
| XLogP | 3.68 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|