C15H19NO2 — CID 122213076
[(1R,2R,5S,6S)-5-amino-2-bicyclo[4.1.0]heptanyl]methyl benzoate (PubChem CID 122213076) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is [(1R,2R,5S,6S)-5-amino-2-bicyclo[4.1.0]heptanyl]methyl benzoate.
| Compound Name | [(1R,2R,5S,6S)-5-amino-2-bicyclo[4.1.0]heptanyl]methyl benzoate |
|---|---|
| PubChem CID | 122213076 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [(1R,2R,5S,6S)-5-amino-2-bicyclo[4.1.0]heptanyl]methyl benzoate |
| SMILES | N[C@H]1CC[C@@H](COC(=O)c2ccccc2)[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C15H19NO2/c16-14-7-6-11(12-8-13(12)14)9-18-15(17)10-4-2-1-3-5-10/h1-5,11-14H,6-9,16H2/t11-,12-,13-,14-/m0/s1 |
| InChIKey | UJUFLJPCEINHDM-XUXIUFHCSA-N |
| XLogP | 2.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |