C20H20O5 — CID 92979836
[(1R,2S,3S)-2-(benzoyloxymethyl)-3-hydroxycyclobutyl]methyl benzoate (PubChem CID 92979836) has the molecular formula C20H20O5 and a molecular weight of 340.37 g/mol. Its IUPAC name is [(1R,2S,3S)-2-(benzoyloxymethyl)-3-hydroxycyclobutyl]methyl benzoate.
| Compound Name | [(1R,2S,3S)-2-(benzoyloxymethyl)-3-hydroxycyclobutyl]methyl benzoate |
|---|---|
| PubChem CID | 92979836 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [(1R,2S,3S)-2-(benzoyloxymethyl)-3-hydroxycyclobutyl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1C[C@H](O)[C@@H]1COC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20O5/c21-18-11-16(12-24-19(22)14-7-3-1-4-8-14)17(18)13-25-20(23)15-9-5-2-6-10-15/h1-10,16-18,21H,11-13H2/t16-,17+,18-/m0/s1 |
| InChIKey | JCLLKKWTDDEQAD-KSZLIROESA-N |
| XLogP | 2.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |