C25H28O5 — CID 134953147
[(1R,2S,3S,4R)-2-(benzoyloxymethyl)-3-hydroxy-4-prop-2-enylcyclohexyl]methyl benzoate (PubChem CID 134953147) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(1R,2S,3S,4R)-2-(benzoyloxymethyl)-3-hydroxy-4-prop-2-enylcyclohexyl]methyl benzoate.
| Compound Name | [(1R,2S,3S,4R)-2-(benzoyloxymethyl)-3-hydroxy-4-prop-2-enylcyclohexyl]methyl benzoate |
|---|---|
| PubChem CID | 134953147 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [(1R,2S,3S,4R)-2-(benzoyloxymethyl)-3-hydroxy-4-prop-2-enylcyclohexyl]methyl benzoate |
| SMILES | C=CC[C@H]1CC[C@@H](COC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C25H28O5/c1-2-9-18-14-15-21(16-29-24(27)19-10-5-3-6-11-19)22(23(18)26)17-30-25(28)20-12-7-4-8-13-20/h2-8,10-13,18,21-23,26H,1,9,14-17H2/t18-,21-,22+,23-/m0/s1 |
| InChIKey | VATAPIXLGJCBHD-IITNATTFSA-N |
| XLogP | 4.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|