C30H28O8 — CID 11049571
[(2R,3R,4R,5S,6R)-3,4-dibenzoyloxy-5-hydroxy-6-prop-2-enyloxan-2-yl]methyl benzoate (PubChem CID 11049571) has the molecular formula C30H28O8 and a molecular weight of 516.55 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3,4-dibenzoyloxy-5-hydroxy-6-prop-2-enyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5S,6R)-3,4-dibenzoyloxy-5-hydroxy-6-prop-2-enyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11049571 |
| Molecular Formula | C30H28O8 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3,4-dibenzoyloxy-5-hydroxy-6-prop-2-enyloxan-2-yl]methyl benzoate |
| SMILES | C=CC[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C30H28O8/c1-2-12-23-25(31)27(38-30(34)22-17-10-5-11-18-22)26(37-29(33)21-15-8-4-9-16-21)24(36-23)19-35-28(32)20-13-6-3-7-14-20/h2-11,13-18,23-27,31H,1,12,19H2/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | DDQHYTWGJZSHJM-IURCNINISA-N |
| XLogP | 4.00 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|