C36H30O10 — CID 11843318
[(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-ethenoxyoxan-2-yl]methyl benzoate (PubChem CID 11843318) has the molecular formula C36H30O10 and a molecular weight of 622.63 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-ethenoxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-ethenoxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11843318 |
| Molecular Formula | C36H30O10 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-ethenoxyoxan-2-yl]methyl benzoate |
| SMILES | C=CO[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H30O10/c1-2-41-36-31(46-35(40)27-21-13-6-14-22-27)30(45-34(39)26-19-11-5-12-20-26)29(44-33(38)25-17-9-4-10-18-25)28(43-36)23-42-32(37)24-15-7-3-8-16-24/h2-22,28-31,36H,1,23H2/t28-,29-,30+,31+,36+/m1/s1 |
| InChIKey | QRJQFYMWZWFCJG-LWBXHBOBSA-N |
| XLogP | 5.41 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|