C24H26O4 — CID 71813940
[(1R,2S,5S)-2-(3-benzoyloxyprop-1-en-2-yl)-5-methylcyclopentyl]methyl benzoate (PubChem CID 71813940) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(1R,2S,5S)-2-(3-benzoyloxyprop-1-en-2-yl)-5-methylcyclopentyl]methyl benzoate.
| Compound Name | [(1R,2S,5S)-2-(3-benzoyloxyprop-1-en-2-yl)-5-methylcyclopentyl]methyl benzoate |
|---|---|
| PubChem CID | 71813940 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [(1R,2S,5S)-2-(3-benzoyloxyprop-1-en-2-yl)-5-methylcyclopentyl]methyl benzoate |
| SMILES | C=C(COC(=O)c1ccccc1)[C@H]1CC[C@H](C)[C@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26O4/c1-17-13-14-21(18(2)15-27-23(25)19-9-5-3-6-10-19)22(17)16-28-24(26)20-11-7-4-8-12-20/h3-12,17,21-22H,2,13-16H2,1H3/t17-,21+,22+/m0/s1 |
| InChIKey | BDVFCYULAUELPA-MTNREXPMSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|