C30H29NO6 — CID 101096496
[(1R,4S,5R,6R)-4-amino-5,6-bis(benzoyloxymethyl)cyclohex-2-en-1-yl]methyl benzoate (PubChem CID 101096496) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is [(1R,4S,5R,6R)-4-amino-5,6-bis(benzoyloxymethyl)cyclohex-2-en-1-yl]methyl benzoate.
| Compound Name | [(1R,4S,5R,6R)-4-amino-5,6-bis(benzoyloxymethyl)cyclohex-2-en-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 101096496 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | [(1R,4S,5R,6R)-4-amino-5,6-bis(benzoyloxymethyl)cyclohex-2-en-1-yl]methyl benzoate |
| SMILES | N[C@H]1C=CC(COC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)[C@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H29NO6/c31-27-17-16-24(18-35-28(32)21-10-4-1-5-11-21)25(19-36-29(33)22-12-6-2-7-13-22)26(27)20-37-30(34)23-14-8-3-9-15-23/h1-17,24-27H,18-20,31H2/t24?,25-,26-,27+/m1/s1 |
| InChIKey | ZYIRYSFCOXICAP-YFNGWOBRSA-N |
| XLogP | 4.30 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|