About (3-oxocyclobutyl)methyl benzoate
(3-oxocyclobutyl)methyl benzoate (PubChem CID 15531476) has the molecular formula C12H12O3
and a molecular weight of 204.23 g/mol. Its IUPAC name is (3-oxocyclobutyl)methyl benzoate.
Molecular Properties
| Compound Name | (3-oxocyclobutyl)methyl benzoate |
| PubChem CID | 15531476 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (3-oxocyclobutyl)methyl benzoate |
| SMILES | O=C1CC(COC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C12H12O3/c13-11-6-9(7-11)8-15-12(14)10-4-2-1-3-5-10/h1-5,9H,6-8H2 |
| InChIKey | AJURBNFYZXOKJD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-oxocyclobutyl)methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxocyclobutyl)methyl benzoate?
The IUPAC name of (3-oxocyclobutyl)methyl benzoate (CID 15531476) is (3-oxocyclobutyl)methyl benzoate.
What is the SMILES notation for (3-oxocyclobutyl)methyl benzoate?
The canonical SMILES for (3-oxocyclobutyl)methyl benzoate is O=C1CC(COC(=O)c2ccccc2)C1.
What is the InChIKey of (3-oxocyclobutyl)methyl benzoate?
The InChIKey is AJURBNFYZXOKJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c13-11-6-9(7-11)8-15-12(14)10-4-2-1-3-5-10/h1-5,9H,6-8H2.
What are the key properties of (3-oxocyclobutyl)methyl benzoate?
(3-oxocyclobutyl)methyl benzoate has a molecular weight of 204.23 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxocyclobutyl)methyl benzoate is sourced from PubChem (CID 15531476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).