C12H12O3 — CID 14796869
[(1S,2R,4R)-5-oxabicyclo[2.1.0]pentan-2-yl]methyl benzoate (PubChem CID 14796869) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is [(1S,2R,4R)-5-oxabicyclo[2.1.0]pentan-2-yl]methyl benzoate.
| Compound Name | [(1S,2R,4R)-5-oxabicyclo[2.1.0]pentan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 14796869 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | [(1S,2R,4R)-5-oxabicyclo[2.1.0]pentan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1C[C@H]2O[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C12H12O3/c13-12(8-4-2-1-3-5-8)14-7-9-6-10-11(9)15-10/h1-5,9-11H,6-7H2/t9-,10-,11+/m1/s1 |
| InChIKey | KKISAWCJTGIRTA-MXWKQRLJSA-N |
| XLogP | 1.63 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|