C14H16O5 — CID 11242511
[(1R,2S,4S,6R)-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-4-yl]methyl benzoate (PubChem CID 11242511) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is [(1R,2S,4S,6R)-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-4-yl]methyl benzoate.
| Compound Name | [(1R,2S,4S,6R)-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 11242511 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [(1R,2S,4S,6R)-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-4-yl]methyl benzoate |
| SMILES | CO[C@H]1O[C@H](COC(=O)c2ccccc2)C[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C14H16O5/c1-16-14-12-11(19-12)7-10(18-14)8-17-13(15)9-5-3-2-4-6-9/h2-6,10-12,14H,7-8H2,1H3/t10-,11+,12+,14-/m0/s1 |
| InChIKey | PWAYOYMSHBKQBG-SFTQSGBHSA-N |
| XLogP | 1.37 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|