C21H22O6 — CID 10339119
[(2S,4R,6S)-4-benzoyloxy-6-methoxyoxan-2-yl]methyl benzoate (PubChem CID 10339119) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is [(2S,4R,6S)-4-benzoyloxy-6-methoxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2S,4R,6S)-4-benzoyloxy-6-methoxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10339119 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [(2S,4R,6S)-4-benzoyloxy-6-methoxyoxan-2-yl]methyl benzoate |
| SMILES | CO[C@@H]1C[C@H](OC(=O)c2ccccc2)C[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C21H22O6/c1-24-19-13-17(27-21(23)16-10-6-3-7-11-16)12-18(26-19)14-25-20(22)15-8-4-2-5-9-15/h2-11,17-19H,12-14H2,1H3/t17-,18+,19+/m1/s1 |
| InChIKey | NWPGEUMXXNXSGN-QYZOEREBSA-N |
| XLogP | 3.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |