C15H20O6 — CID 70223432
[(2S,4R,5S)-4-hydroxy-5-(2-methoxyethoxy)oxolan-2-yl]methyl benzoate (PubChem CID 70223432) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is [(2S,4R,5S)-4-hydroxy-5-(2-methoxyethoxy)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,4R,5S)-4-hydroxy-5-(2-methoxyethoxy)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70223432 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [(2S,4R,5S)-4-hydroxy-5-(2-methoxyethoxy)oxolan-2-yl]methyl benzoate |
| SMILES | COCCO[C@H]1O[C@H](COC(=O)c2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C15H20O6/c1-18-7-8-19-15-13(16)9-12(21-15)10-20-14(17)11-5-3-2-4-6-11/h2-6,12-13,15-16H,7-10H2,1H3/t12-,13+,15-/m0/s1 |
| InChIKey | CRCRHHVMCSZYNV-GUTXKFCHSA-N |
| XLogP | 0.98 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|