C19H19ClO3 — CID 102148599
[(2R,4S,6S)-4-chloro-6-phenyloxan-2-yl]methyl benzoate (PubChem CID 102148599) has the molecular formula C19H19ClO3 and a molecular weight of 330.81 g/mol. Its IUPAC name is [(2R,4S,6S)-4-chloro-6-phenyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,4S,6S)-4-chloro-6-phenyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102148599 |
| Molecular Formula | C19H19ClO3 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [(2R,4S,6S)-4-chloro-6-phenyloxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1C[C@@H](Cl)C[C@@H](c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C19H19ClO3/c20-16-11-17(13-22-19(21)15-9-5-2-6-10-15)23-18(12-16)14-7-3-1-4-8-14/h1-10,16-18H,11-13H2/t16-,17-,18+/m1/s1 |
| InChIKey | JPBJAQHBQJNBAN-KURKYZTESA-N |
| XLogP | 4.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|