C18H19NO3 — CID 3660797
(2-methyl-3-phenyl-1,2-oxazolidin-5-yl)methyl benzoate (PubChem CID 3660797) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2-methyl-3-phenyl-1,2-oxazolidin-5-yl)methyl benzoate.
| Compound Name | (2-methyl-3-phenyl-1,2-oxazolidin-5-yl)methyl benzoate |
|---|---|
| PubChem CID | 3660797 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2-methyl-3-phenyl-1,2-oxazolidin-5-yl)methyl benzoate |
| SMILES | CN1OC(COC(=O)c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-19-17(14-8-4-2-5-9-14)12-16(22-19)13-21-18(20)15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3 |
| InChIKey | UPPRNEICQQKLGC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |