C12H14O4S — CID 131847754
[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]methyl benzoate (PubChem CID 131847754) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is [2-(hydroxymethyl)-1,3-oxathiolan-5-yl]methyl benzoate.
| Compound Name | [2-(hydroxymethyl)-1,3-oxathiolan-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 131847754 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | [2-(hydroxymethyl)-1,3-oxathiolan-5-yl]methyl benzoate |
| SMILES | O=C(OCC1CSC(CO)O1)c1ccccc1 |
| InChI | InChI=1S/C12H14O4S/c13-6-11-16-10(8-17-11)7-15-12(14)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2 |
| InChIKey | DUQDDZMDICNXAT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |