C13H16O4S — CID 11161502
[(2S,5R)-5-ethoxy-1,3-oxathiolan-2-yl]methyl benzoate (PubChem CID 11161502) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is [(2S,5R)-5-ethoxy-1,3-oxathiolan-2-yl]methyl benzoate.
| Compound Name | [(2S,5R)-5-ethoxy-1,3-oxathiolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11161502 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | [(2S,5R)-5-ethoxy-1,3-oxathiolan-2-yl]methyl benzoate |
| SMILES | CCO[C@H]1CS[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C13H16O4S/c1-2-15-11-9-18-12(17-11)8-16-13(14)10-6-4-3-5-7-10/h3-7,11-12H,2,8-9H2,1H3/t11-,12+/m1/s1 |
| InChIKey | HKCZGPSAMRMJLZ-NEPJUHHUSA-N |
| XLogP | 2.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |