C19H29O7P — CID 15835070
[(2S,3S,5R)-3-(diethoxyphosphorylmethyl)-5-ethoxyoxolan-2-yl]methyl benzoate (PubChem CID 15835070) has the molecular formula C19H29O7P and a molecular weight of 400.41 g/mol. Its IUPAC name is [(2S,3S,5R)-3-(diethoxyphosphorylmethyl)-5-ethoxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3S,5R)-3-(diethoxyphosphorylmethyl)-5-ethoxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 15835070 |
| Molecular Formula | C19H29O7P |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [(2S,3S,5R)-3-(diethoxyphosphorylmethyl)-5-ethoxyoxolan-2-yl]methyl benzoate |
| SMILES | CCO[C@H]1C[C@H](CP(=O)(OCC)OCC)[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C19H29O7P/c1-4-22-18-12-16(14-27(21,24-5-2)25-6-3)17(26-18)13-23-19(20)15-10-8-7-9-11-15/h7-11,16-18H,4-6,12-14H2,1-3H3/t16-,17-,18-/m1/s1 |
| InChIKey | VORJUGWSCSKVBB-KZNAEPCWSA-N |
| XLogP | 3.88 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|