C18H26O5 — CID 71020807
[(2S,3R)-2-(butoxymethyl)-5-methoxyoxolan-3-yl]methyl benzoate (PubChem CID 71020807) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is [(2S,3R)-2-(butoxymethyl)-5-methoxyoxolan-3-yl]methyl benzoate.
| Compound Name | [(2S,3R)-2-(butoxymethyl)-5-methoxyoxolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 71020807 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | [(2S,3R)-2-(butoxymethyl)-5-methoxyoxolan-3-yl]methyl benzoate |
| SMILES | CCCCOC[C@H]1OC(OC)C[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O5/c1-3-4-10-21-13-16-15(11-17(20-2)23-16)12-22-18(19)14-8-6-5-7-9-14/h5-9,15-17H,3-4,10-13H2,1-2H3/t15-,16-,17?/m1/s1 |
| InChIKey | CRKMQXQWSXNLAO-YNPPLXCJSA-N |
| XLogP | 3.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|