C17H24O5 — CID 171770465
[(2R,3S)-2-(butoxymethyl)-5-hydroxyoxolan-3-yl]methyl benzoate (PubChem CID 171770465) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(2R,3S)-2-(butoxymethyl)-5-hydroxyoxolan-3-yl]methyl benzoate.
| Compound Name | [(2R,3S)-2-(butoxymethyl)-5-hydroxyoxolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 171770465 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(2R,3S)-2-(butoxymethyl)-5-hydroxyoxolan-3-yl]methyl benzoate |
| SMILES | CCCCOC[C@@H]1OC(O)C[C@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24O5/c1-2-3-9-20-12-15-14(10-16(18)22-15)11-21-17(19)13-7-5-4-6-8-13/h4-8,14-16,18H,2-3,9-12H2,1H3/t14-,15-,16?/m0/s1 |
| InChIKey | FQWAVLHDBUUGBS-KSCSMHSMSA-N |
| XLogP | 2.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|