C25H40O7 — CID 118120279
[(3R,5S,6R)-3,4,5-tributoxy-6-hydroxyoxan-2-yl]methyl benzoate (PubChem CID 118120279) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is [(3R,5S,6R)-3,4,5-tributoxy-6-hydroxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3R,5S,6R)-3,4,5-tributoxy-6-hydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 118120279 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | [(3R,5S,6R)-3,4,5-tributoxy-6-hydroxyoxan-2-yl]methyl benzoate |
| SMILES | CCCCOC1[C@H](OCCCC)C(COC(=O)c2ccccc2)O[C@@H](O)[C@H]1OCCCC |
| InChI | InChI=1S/C25H40O7/c1-4-7-15-28-21-20(18-31-24(26)19-13-11-10-12-14-19)32-25(27)23(30-17-9-6-3)22(21)29-16-8-5-2/h10-14,20-23,25,27H,4-9,15-18H2,1-3H3/t20?,21-,22?,23+,25-/m1/s1 |
| InChIKey | QLIYFXQXTHZKOL-WXSUXYJHSA-N |
| XLogP | 4.12 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|