C28H26O8 — CID 171124322
[4-benzoyloxy-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 171124322) has the molecular formula C28H26O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is [4-benzoyloxy-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [4-benzoyloxy-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 171124322 |
| Molecular Formula | C28H26O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [4-benzoyloxy-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC2OC(O)C(OC(=O)c3ccccc3)C2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H26O8/c1-17-8-12-20(13-9-17)25(29)33-16-22-23(35-27(31)21-14-10-18(2)11-15-21)24(28(32)34-22)36-26(30)19-6-4-3-5-7-19/h3-15,22-24,28,32H,16H2,1-2H3 |
| InChIKey | GKTPBLCTWYKTQA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|