C29H27NO9 — CID 14393274
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-dibenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate (PubChem CID 14393274) has the molecular formula C29H27NO9 and a molecular weight of 533.53 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-3,4-dibenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-dibenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 14393274 |
| Molecular Formula | C29H27NO9 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-dibenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@@H]1O |
| InChI | InChI=1S/C29H27NO9/c1-18(31)30-23-25(39-28(34)21-15-9-4-10-16-21)24(38-27(33)20-13-7-3-8-14-20)22(37-29(23)35)17-36-26(32)19-11-5-2-6-12-19/h2-16,22-25,29,35H,17H2,1H3,(H,30,31)/t22-,23-,24-,25-,29+/m1/s1 |
| InChIKey | KESYOCSVVBUWEQ-LPSUVQJGSA-N |
| XLogP | 2.52 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|