C35H37NO10 — CID 59253377
[(3R,4R,6R)-5-acetamido-3,4-dibenzoyloxy-6-(5-oxohexoxy)oxan-2-yl]methyl benzoate (PubChem CID 59253377) has the molecular formula C35H37NO10 and a molecular weight of 631.68 g/mol. Its IUPAC name is [(3R,4R,6R)-5-acetamido-3,4-dibenzoyloxy-6-(5-oxohexoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(3R,4R,6R)-5-acetamido-3,4-dibenzoyloxy-6-(5-oxohexoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 59253377 |
| Molecular Formula | C35H37NO10 |
| Molecular Weight | 631.68 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | [(3R,4R,6R)-5-acetamido-3,4-dibenzoyloxy-6-(5-oxohexoxy)oxan-2-yl]methyl benzoate |
| SMILES | CC(=O)CCCCO[C@@H]1OC(COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C1NC(C)=O |
| InChI | InChI=1S/C35H37NO10/c1-23(37)14-12-13-21-42-35-29(36-24(2)38)31(46-34(41)27-19-10-5-11-20-27)30(45-33(40)26-17-8-4-9-18-26)28(44-35)22-43-32(39)25-15-6-3-7-16-25/h3-11,15-20,28-31,35H,12-14,21-22H2,1-2H3,(H,36,38)/t28?,29?,30-,31+,35+/m0/s1 |
| InChIKey | CZZNVFUGXNZJQP-ZFNGFCEZSA-N |
| XLogP | 4.30 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|