C40H46N2O11 — CID 172767237
[(2R,3R,4R,5R,6R)-5-acetamido-3,4-dibenzoyloxy-6-[5-oxo-5-(6-oxohexylamino)pentoxy]oxan-2-yl]methyl benzoate (PubChem CID 172767237) has the molecular formula C40H46N2O11 and a molecular weight of 730.81 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-5-acetamido-3,4-dibenzoyloxy-6-[5-oxo-5-(6-oxohexylamino)pentoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-dibenzoyloxy-6-[5-oxo-5-(6-oxohexylamino)pentoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 172767237 |
| Molecular Formula | C40H46N2O11 |
| Molecular Weight | 730.81 g/mol |
| Exact Mass | 730.31 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-acetamido-3,4-dibenzoyloxy-6-[5-oxo-5-(6-oxohexylamino)pentoxy]oxan-2-yl]methyl benzoate |
| SMILES | CC(=O)N[C@H]1[C@H](OCCCCC(=O)NCCCCCC=O)O[C@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H46N2O11/c1-28(44)42-34-36(53-39(48)31-21-11-6-12-22-31)35(52-38(47)30-19-9-5-10-20-30)32(27-50-37(46)29-17-7-4-8-18-29)51-40(34)49-26-16-13-23-33(45)41-24-14-2-3-15-25-43/h4-12,17-22,25,32,34-36,40H,2-3,13-16,23-24,26-27H2,1H3,(H,41,45)(H,42,44)/t32-,34-,35+,36-,40-/m1/s1 |
| InChIKey | MMBDMNBGPWIHBT-HKRIWCNVSA-N |
| XLogP | 4.59 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.81 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|