C35H37NO11 — CID 90058917
[5-acetamido-3,4-dibenzoyloxy-6-(5-methoxy-5-oxopentoxy)oxan-2-yl]methyl benzoate (PubChem CID 90058917) has the molecular formula C35H37NO11 and a molecular weight of 647.68 g/mol. Its IUPAC name is [5-acetamido-3,4-dibenzoyloxy-6-(5-methoxy-5-oxopentoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [5-acetamido-3,4-dibenzoyloxy-6-(5-methoxy-5-oxopentoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90058917 |
| Molecular Formula | C35H37NO11 |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | [5-acetamido-3,4-dibenzoyloxy-6-(5-methoxy-5-oxopentoxy)oxan-2-yl]methyl benzoate |
| SMILES | COC(=O)CCCCOC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1NC(C)=O |
| InChI | InChI=1S/C35H37NO11/c1-23(37)36-29-31(47-34(41)26-18-10-5-11-19-26)30(46-33(40)25-16-8-4-9-17-25)27(22-44-32(39)24-14-6-3-7-15-24)45-35(29)43-21-13-12-20-28(38)42-2/h3-11,14-19,27,29-31,35H,12-13,20-22H2,1-2H3,(H,36,37) |
| InChIKey | BCTYUSPPSRBLQM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|