C40H47NO10 — CID 59306067
[(3R,4R,6R)-5-acetamido-3,4-dibenzoyloxy-6-(6,6,7-trimethyl-5-oxooctoxy)oxan-2-yl]methyl benzoate (PubChem CID 59306067) has the molecular formula C40H47NO10 and a molecular weight of 701.81 g/mol. Its IUPAC name is [(3R,4R,6R)-5-acetamido-3,4-dibenzoyloxy-6-(6,6,7-trimethyl-5-oxooctoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(3R,4R,6R)-5-acetamido-3,4-dibenzoyloxy-6-(6,6,7-trimethyl-5-oxooctoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 59306067 |
| Molecular Formula | C40H47NO10 |
| Molecular Weight | 701.81 g/mol |
| Exact Mass | 701.32 |
| IUPAC Name | [(3R,4R,6R)-5-acetamido-3,4-dibenzoyloxy-6-(6,6,7-trimethyl-5-oxooctoxy)oxan-2-yl]methyl benzoate |
| SMILES | CC(=O)NC1[C@H](OCCCCC(=O)C(C)(C)C(C)C)OC(COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H47NO10/c1-26(2)40(4,5)32(43)23-15-16-24-47-39-33(41-27(3)42)35(51-38(46)30-21-13-8-14-22-30)34(50-37(45)29-19-11-7-12-20-29)31(49-39)25-48-36(44)28-17-9-6-10-18-28/h6-14,17-22,26,31,33-35,39H,15-16,23-25H2,1-5H3,(H,41,42)/t31?,33?,34-,35+,39+/m0/s1 |
| InChIKey | IJBGBTWZBSTJMY-XSOZBLDCSA-N |
| XLogP | 5.96 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.81 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|