C39H46O9 — CID 162216647
[(3S,4S,6S)-3,5-dibenzoyloxy-4-methyl-6-(6,6,7-trimethyl-5-oxooctoxy)oxan-2-yl]methyl benzoate (PubChem CID 162216647) has the molecular formula C39H46O9 and a molecular weight of 658.79 g/mol. Its IUPAC name is [(3S,4S,6S)-3,5-dibenzoyloxy-4-methyl-6-(6,6,7-trimethyl-5-oxooctoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(3S,4S,6S)-3,5-dibenzoyloxy-4-methyl-6-(6,6,7-trimethyl-5-oxooctoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 162216647 |
| Molecular Formula | C39H46O9 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | [(3S,4S,6S)-3,5-dibenzoyloxy-4-methyl-6-(6,6,7-trimethyl-5-oxooctoxy)oxan-2-yl]methyl benzoate |
| SMILES | CC(C)C(C)(C)C(=O)CCCCO[C@H]1OC(COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C39H46O9/c1-26(2)39(4,5)32(40)23-15-16-24-44-38-34(48-37(43)30-21-13-8-14-22-30)27(3)33(47-36(42)29-19-11-7-12-20-29)31(46-38)25-45-35(41)28-17-9-6-10-18-28/h6-14,17-22,26-27,31,33-34,38H,15-16,23-25H2,1-5H3/t27-,31?,33-,34?,38-/m0/s1 |
| InChIKey | BNDPVUARPKRHBJ-FGXUKEOPSA-N |
| XLogP | 7.09 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|