C58H62O11Si — CID 71814070
[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[8-[tert-butyl(diphenyl)silyl]oxyoctoxy]oxan-2-yl]methyl benzoate (PubChem CID 71814070) has the molecular formula C58H62O11Si and a molecular weight of 963.21 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[8-[tert-butyl(diphenyl)silyl]oxyoctoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[8-[tert-butyl(diphenyl)silyl]oxyoctoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71814070 |
| Molecular Formula | C58H62O11Si |
| Molecular Weight | 963.21 g/mol |
| Exact Mass | 962.41 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[8-[tert-butyl(diphenyl)silyl]oxyoctoxy]oxan-2-yl]methyl benzoate |
| SMILES | CC(C)(C)[Si](OCCCCCCCCO[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C58H62O11Si/c1-58(2,3)70(47-36-22-12-23-37-47,48-38-24-13-25-39-48)65-41-27-7-5-4-6-26-40-63-57-52(69-56(62)46-34-20-11-21-35-46)51(68-55(61)45-32-18-10-19-33-45)50(67-54(60)44-30-16-9-17-31-44)49(66-57)42-64-53(59)43-28-14-8-15-29-43/h8-25,28-39,49-52,57H,4-7,26-27,40-42H2,1-3H3/t49-,50-,51+,52-,57-/m1/s1 |
| InChIKey | RPDMYFNOGQXWGG-DPAXTVHGSA-N |
| XLogP | 10.18 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.21 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|