C32H36O9Si — CID 102271030
[(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-5-hydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate (PubChem CID 102271030) has the molecular formula C32H36O9Si and a molecular weight of 592.72 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-5-hydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-5-hydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102271030 |
| Molecular Formula | C32H36O9Si |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-5-hydroxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate |
| SMILES | C[Si](C)(C)CCO[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C32H36O9Si/c1-42(2,3)20-19-37-32-26(33)28(41-31(36)24-17-11-6-12-18-24)27(40-30(35)23-15-9-5-10-16-23)25(39-32)21-38-29(34)22-13-7-4-8-14-22/h4-18,25-28,32-33H,19-21H2,1-3H3/t25-,26-,27+,28-,32-/m1/s1 |
| InChIKey | QQSMRJNYSZYJNF-WLDPWVQSSA-N |
| XLogP | 4.74 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|