C29H27BrO9 — CID 101029156
[(2R,3R,4S,5R,6R)-3,5-dibenzoyloxy-6-(2-bromoethoxy)-4-hydroxyoxan-2-yl]methyl benzoate (PubChem CID 101029156) has the molecular formula C29H27BrO9 and a molecular weight of 599.43 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-dibenzoyloxy-6-(2-bromoethoxy)-4-hydroxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-dibenzoyloxy-6-(2-bromoethoxy)-4-hydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101029156 |
| Molecular Formula | C29H27BrO9 |
| Molecular Weight | 599.43 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-dibenzoyloxy-6-(2-bromoethoxy)-4-hydroxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](OCCBr)[C@H](OC(=O)c2ccccc2)[C@@H](O)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27BrO9/c30-16-17-35-29-25(39-28(34)21-14-8-3-9-15-21)23(31)24(38-27(33)20-12-6-2-7-13-20)22(37-29)18-36-26(32)19-10-4-1-5-11-19/h1-15,22-25,29,31H,16-18H2/t22-,23+,24+,25-,29-/m1/s1 |
| InChIKey | RXXQELJZCCSGFW-MOHFTYJVSA-N |
| XLogP | 3.79 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|