C56H64O15Si2 — CID 87776568
[(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(3R,4S,5R,6R)-5-benzoyloxy-4,6-bis(2-trimethylsilylethoxy)oxan-3-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 87776568) has the molecular formula C56H64O15Si2 and a molecular weight of 1033.29 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(3R,4S,5R,6R)-5-benzoyloxy-4,6-bis(2-trimethylsilylethoxy)oxan-3-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(3R,4S,5R,6R)-5-benzoyloxy-4,6-bis(2-trimethylsilylethoxy)oxan-3-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 87776568 |
| Molecular Formula | C56H64O15Si2 |
| Molecular Weight | 1033.29 g/mol |
| Exact Mass | 1032.38 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(3R,4S,5R,6R)-5-benzoyloxy-4,6-bis(2-trimethylsilylethoxy)oxan-3-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | C[Si](C)(C)CCO[C@H]1OC[C@@H](O[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)[C@H](OCC[Si](C)(C)C)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C56H64O15Si2/c1-72(2,3)34-32-62-45-43(37-65-55(63-33-35-73(4,5)6)48(45)70-53(60)41-28-18-10-19-29-41)66-56-49(71-54(61)42-30-20-11-21-31-42)47(69-52(59)40-26-16-9-17-27-40)46(68-51(58)39-24-14-8-15-25-39)44(67-56)36-64-50(57)38-22-12-7-13-23-38/h7-31,43-49,55-56H,32-37H2,1-6H3/t43-,44-,45+,46+,47+,48-,49-,55+,56-/m1/s1 |
| InChIKey | WSLLANFUYIODBL-SGDKIZMKSA-N |
| XLogP | 9.29 |
| TPSA | 177.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.29 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|