C25H34O7Si — CID 70358741
[(2R,3S,4S,5R,6S)-3,5-dihydroxy-4-phenylmethoxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate (PubChem CID 70358741) has the molecular formula C25H34O7Si and a molecular weight of 474.63 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,5-dihydroxy-4-phenylmethoxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,5-dihydroxy-4-phenylmethoxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70358741 |
| Molecular Formula | C25H34O7Si |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,5-dihydroxy-4-phenylmethoxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate |
| SMILES | C[Si](C)(C)CCO[C@H]1O[C@H](COC(=O)c2ccccc2)[C@H](O)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C25H34O7Si/c1-33(2,3)15-14-29-25-22(27)23(30-16-18-10-6-4-7-11-18)21(26)20(32-25)17-31-24(28)19-12-8-5-9-13-19/h4-13,20-23,25-27H,14-17H2,1-3H3/t20-,21+,22-,23+,25+/m1/s1 |
| InChIKey | SYCYRAXDCDKKIR-TZCXNXGPSA-N |
| XLogP | 3.23 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|