C22H34O8Si — CID 11798000
[(2R,3S,4S,5R,6R)-5-acetyloxy-3-hydroxy-2-(phenylmethoxymethyl)-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate (PubChem CID 11798000) has the molecular formula C22H34O8Si and a molecular weight of 454.59 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-acetyloxy-3-hydroxy-2-(phenylmethoxymethyl)-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3-hydroxy-2-(phenylmethoxymethyl)-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 11798000 |
| Molecular Formula | C22H34O8Si |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3-hydroxy-2-(phenylmethoxymethyl)-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OCC[Si](C)(C)C)O[C@H](COCc2ccccc2)[C@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H34O8Si/c1-15(23)28-20-19(25)18(14-26-13-17-9-7-6-8-10-17)30-22(21(20)29-16(2)24)27-11-12-31(3,4)5/h6-10,18-22,25H,11-14H2,1-5H3/t18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | GOQGDQTUZQDSDT-CDJZJNNCSA-N |
| XLogP | 2.51 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|