C25H28O10 — CID 134277145
[(2S,3R,4S,5R,6R)-3-acetyloxy-2-(4-acetyloxyphenoxy)-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] acetate (PubChem CID 134277145) has the molecular formula C25H28O10 and a molecular weight of 488.49 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3-acetyloxy-2-(4-acetyloxyphenoxy)-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-3-acetyloxy-2-(4-acetyloxyphenoxy)-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 134277145 |
| Molecular Formula | C25H28O10 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3-acetyloxy-2-(4-acetyloxyphenoxy)-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)Oc1ccc(O[C@@H]2O[C@H](COCc3ccccc3)[C@@H](O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C25H28O10/c1-15(26)31-19-9-11-20(12-10-19)34-25-24(33-17(3)28)23(32-16(2)27)22(29)21(35-25)14-30-13-18-7-5-4-6-8-18/h4-12,21-25,29H,13-14H2,1-3H3/t21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | WJIKIALFFCTXMF-NHTNDUFYSA-N |
| XLogP | 2.16 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|