C39H34O8 — CID 123417894
[5-benzoyloxy-3-hydroxy-2-(phenylmethoxymethyl)-6-(4-phenylphenoxy)oxan-4-yl] benzoate (PubChem CID 123417894) has the molecular formula C39H34O8 and a molecular weight of 630.69 g/mol. Its IUPAC name is [5-benzoyloxy-3-hydroxy-2-(phenylmethoxymethyl)-6-(4-phenylphenoxy)oxan-4-yl] benzoate.
| Compound Name | [5-benzoyloxy-3-hydroxy-2-(phenylmethoxymethyl)-6-(4-phenylphenoxy)oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 123417894 |
| Molecular Formula | C39H34O8 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | [5-benzoyloxy-3-hydroxy-2-(phenylmethoxymethyl)-6-(4-phenylphenoxy)oxan-4-yl] benzoate |
| SMILES | O=C(OC1C(Oc2ccc(-c3ccccc3)cc2)OC(COCc2ccccc2)C(O)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H34O8/c40-34-33(26-43-25-27-13-5-1-6-14-27)45-39(44-32-23-21-29(22-24-32)28-15-7-2-8-16-28)36(47-38(42)31-19-11-4-12-20-31)35(34)46-37(41)30-17-9-3-10-18-30/h1-24,33-36,39-40H,25-26H2 |
| InChIKey | BBPSZWPPOZPGRA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |