C29H29N3O8 — CID 175255081
[(2R,3R,4S,5R,6R)-2-(2-azidoethoxy)-3-benzoyloxy-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] benzoate (PubChem CID 175255081) has the molecular formula C29H29N3O8 and a molecular weight of 547.56 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-(2-azidoethoxy)-3-benzoyloxy-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-2-(2-azidoethoxy)-3-benzoyloxy-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 175255081 |
| Molecular Formula | C29H29N3O8 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-(2-azidoethoxy)-3-benzoyloxy-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl] benzoate |
| SMILES | [N-]=[N+]=NCCO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H29N3O8/c30-32-31-16-17-37-29-26(40-28(35)22-14-8-3-9-15-22)25(39-27(34)21-12-6-2-7-13-21)24(33)23(38-29)19-36-18-20-10-4-1-5-11-20/h1-15,23-26,29,33H,16-19H2/t23-,24-,25+,26-,29-/m1/s1 |
| InChIKey | MOKMOCROWAYICT-MWRXUHODSA-N |
| XLogP | 4.07 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|