C44H47N3O11 — CID 160614216
[6-[6-(2-azidoethoxy)-5-benzoyloxy-4-methyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 160614216) has the molecular formula C44H47N3O11 and a molecular weight of 793.87 g/mol. Its IUPAC name is [6-[6-(2-azidoethoxy)-5-benzoyloxy-4-methyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [6-[6-(2-azidoethoxy)-5-benzoyloxy-4-methyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 160614216 |
| Molecular Formula | C44H47N3O11 |
| Molecular Weight | 793.87 g/mol |
| Exact Mass | 793.32 |
| IUPAC Name | [6-[6-(2-azidoethoxy)-5-benzoyloxy-4-methyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CC1C2OC(c3ccccc3)OCC2OC(OC2C(COCc3ccccc3)OC(OCCN=[N+]=[N-])C(OC(=O)c3ccccc3)C2C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C44H47N3O11/c1-28-36(34(26-50-25-30-15-7-3-8-16-30)53-43(51-24-23-46-47-45)38(28)55-40(48)31-17-9-4-10-18-31)58-44-39(56-41(49)32-19-11-5-12-20-32)29(2)37-35(54-44)27-52-42(57-37)33-21-13-6-14-22-33/h3-22,28-29,34-39,42-44H,23-27H2,1-2H3 |
| InChIKey | RFWMNAZSRVVQOA-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 165.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.87 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|