C35H41N3O9 — CID 161354385
[(2S,5R,6S)-5-[(2R,4R,5S)-3-azido-5-hydroxy-4-methyl-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 161354385) has the molecular formula C35H41N3O9 and a molecular weight of 647.73 g/mol. Its IUPAC name is [(2S,5R,6S)-5-[(2R,4R,5S)-3-azido-5-hydroxy-4-methyl-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,5R,6S)-5-[(2R,4R,5S)-3-azido-5-hydroxy-4-methyl-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 161354385 |
| Molecular Formula | C35H41N3O9 |
| Molecular Weight | 647.73 g/mol |
| Exact Mass | 647.28 |
| IUPAC Name | [(2S,5R,6S)-5-[(2R,4R,5S)-3-azido-5-hydroxy-4-methyl-6-(phenylmethoxymethyl)oxan-2-yl]oxy-2-methoxy-6-methyl-4-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@@H](C)[C@@H](O[C@H]2OC(COCc3ccccc3)[C@@H](O)[C@H](C)C2N=[N+]=[N-])C(OCc2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H41N3O9/c1-22-28(37-38-36)34(45-27(29(22)39)21-42-19-24-13-7-4-8-14-24)47-30-23(2)44-35(41-3)32(46-33(40)26-17-11-6-12-18-26)31(30)43-20-25-15-9-5-10-16-25/h4-18,22-23,27-32,34-35,39H,19-21H2,1-3H3/t22-,23+,27?,28?,29+,30-,31?,32?,34-,35+/m1/s1 |
| InChIKey | QEEBRWRIVCNDSF-LJPWYNKFSA-N |
| XLogP | 5.19 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.73 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|