C36H39N3O11 — CID 158781291
[(3S,4R,6S)-3-[(2R,3S,5S)-6-acetyl-3-benzoyloxy-5-hydroxy-4-phenylmethoxyoxan-2-yl]oxy-5-azido-6-methoxy-4-methyloxan-2-yl]methyl benzoate (PubChem CID 158781291) has the molecular formula C36H39N3O11 and a molecular weight of 689.72 g/mol. Its IUPAC name is [(3S,4R,6S)-3-[(2R,3S,5S)-6-acetyl-3-benzoyloxy-5-hydroxy-4-phenylmethoxyoxan-2-yl]oxy-5-azido-6-methoxy-4-methyloxan-2-yl]methyl benzoate.
| Compound Name | [(3S,4R,6S)-3-[(2R,3S,5S)-6-acetyl-3-benzoyloxy-5-hydroxy-4-phenylmethoxyoxan-2-yl]oxy-5-azido-6-methoxy-4-methyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 158781291 |
| Molecular Formula | C36H39N3O11 |
| Molecular Weight | 689.72 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | [(3S,4R,6S)-3-[(2R,3S,5S)-6-acetyl-3-benzoyloxy-5-hydroxy-4-phenylmethoxyoxan-2-yl]oxy-5-azido-6-methoxy-4-methyloxan-2-yl]methyl benzoate |
| SMILES | CO[C@H]1OC(COC(=O)c2ccccc2)[C@@H](O[C@@H]2OC(C(C)=O)[C@@H](O)C(OCc3ccccc3)[C@@H]2OC(=O)c2ccccc2)[C@H](C)C1N=[N+]=[N-] |
| InChI | InChI=1S/C36H39N3O11/c1-21-27(38-39-37)35(44-3)47-26(20-46-33(42)24-15-9-5-10-16-24)29(21)49-36-32(48-34(43)25-17-11-6-12-18-25)31(28(41)30(50-36)22(2)40)45-19-23-13-7-4-8-14-23/h4-18,21,26-32,35-36,41H,19-20H2,1-3H3/t21-,26?,27?,28-,29+,30?,31?,32+,35+,36-/m1/s1 |
| InChIKey | ICGJWIFSSBZXMH-MHQQMSLXSA-N |
| XLogP | 4.40 |
| TPSA | 184.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|