C38H44O13 — CID 102394562
[(2S,3R,4S,5R,6R)-4-[(2S,3S,4R,5R,6S)-4,5-diacetyloxy-6-methyl-3-phenylmethoxyoxan-2-yl]oxy-5-hydroxy-2-methoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate (PubChem CID 102394562) has the molecular formula C38H44O13 and a molecular weight of 708.76 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4-[(2S,3S,4R,5R,6S)-4,5-diacetyloxy-6-methyl-3-phenylmethoxyoxan-2-yl]oxy-5-hydroxy-2-methoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-4-[(2S,3S,4R,5R,6S)-4,5-diacetyloxy-6-methyl-3-phenylmethoxyoxan-2-yl]oxy-5-hydroxy-2-methoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 102394562 |
| Molecular Formula | C38H44O13 |
| Molecular Weight | 708.76 g/mol |
| Exact Mass | 708.28 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4-[(2S,3S,4R,5R,6S)-4,5-diacetyloxy-6-methyl-3-phenylmethoxyoxan-2-yl]oxy-5-hydroxy-2-methoxy-6-(phenylmethoxymethyl)oxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](O[C@@H]2O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OCc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H44O13/c1-23-31(47-24(2)39)33(48-25(3)40)34(45-21-27-16-10-6-11-17-27)38(46-23)51-32-30(41)29(22-44-20-26-14-8-5-9-15-26)49-37(43-4)35(32)50-36(42)28-18-12-7-13-19-28/h5-19,23,29-35,37-38,41H,20-22H2,1-4H3/t23-,29+,30+,31+,32-,33+,34-,35+,37-,38-/m0/s1 |
| InChIKey | IZPIGSJDNWNEHA-MXJMVHFSSA-N |
| XLogP | 3.74 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|