C35H43NO14 — CID 102389941
[(2R,3R,4R,5S,6R)-3-acetamido-2-methoxy-6-(phenylmethoxymethyl)-5-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-4-yl] benzoate (PubChem CID 102389941) has the molecular formula C35H43NO14 and a molecular weight of 701.72 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3-acetamido-2-methoxy-6-(phenylmethoxymethyl)-5-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-4-yl] benzoate.
| Compound Name | [(2R,3R,4R,5S,6R)-3-acetamido-2-methoxy-6-(phenylmethoxymethyl)-5-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 102389941 |
| Molecular Formula | C35H43NO14 |
| Molecular Weight | 701.72 g/mol |
| Exact Mass | 701.27 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3-acetamido-2-methoxy-6-(phenylmethoxymethyl)-5-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-4-yl] benzoate |
| SMILES | CO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O[C@@H]2O[C@@H](C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(=O)c2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C35H43NO14/c1-19-28(45-21(3)38)31(46-22(4)39)32(47-23(5)40)35(44-19)50-29-26(18-43-17-24-13-9-7-10-14-24)48-34(42-6)27(36-20(2)37)30(29)49-33(41)25-15-11-8-12-16-25/h7-16,19,26-32,34-35H,17-18H2,1-6H3,(H,36,37)/t19-,26+,27+,28-,29+,30+,31+,32+,34+,35-/m0/s1 |
| InChIKey | VKKGOTRRFWXELV-GBRIKOCQSA-N |
| XLogP | 2.23 |
| TPSA | 180.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.72 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|